C11H15N — CID 118155644
(2S,3R)-2,3-dimethyl-1-(2-methylphenyl)aziridine (PubChem CID 118155644) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyl-1-(2-methylphenyl)aziridine.
| Compound Name | (2S,3R)-2,3-dimethyl-1-(2-methylphenyl)aziridine |
|---|---|
| PubChem CID | 118155644 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2S,3R)-2,3-dimethyl-1-(2-methylphenyl)aziridine |
| SMILES | Cc1ccccc1N1[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H15N/c1-8-6-4-5-7-11(8)12-9(2)10(12)3/h4-7,9-10H,1-3H3/t9-,10+,12? |
| InChIKey | LAPRMGSATQYNFK-DHHPTOIESA-N |
| XLogP | 2.59 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|