C13H20N2 — CID 27311881
(2S,6R)-2,6-dimethyl-1-(2-methylphenyl)piperazine (PubChem CID 27311881) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-(2-methylphenyl)piperazine.
| Compound Name | (2S,6R)-2,6-dimethyl-1-(2-methylphenyl)piperazine |
|---|---|
| PubChem CID | 27311881 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-(2-methylphenyl)piperazine |
| SMILES | Cc1ccccc1N1[C@H](C)CNC[C@@H]1C |
| InChI | InChI=1S/C13H20N2/c1-10-6-4-5-7-13(10)15-11(2)8-14-9-12(15)3/h4-7,11-12,14H,8-9H2,1-3H3/t11-,12+ |
| InChIKey | NDHVNJMTOCZUEU-TXEJJXNPSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |