C13H19ClN2 — CID 42079394
(2R,6R)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine (PubChem CID 42079394) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is (2R,6R)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine.
| Compound Name | (2R,6R)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 42079394 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,6R)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine |
| SMILES | Cc1c(Cl)cccc1N1[C@H](C)CNC[C@H]1C |
| InChI | InChI=1S/C13H19ClN2/c1-9-7-15-8-10(2)16(9)13-6-4-5-12(14)11(13)3/h4-6,9-10,15H,7-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | KPIUJOCQDXHOQX-NXEZZACHSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |