About 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane
2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane (PubChem CID 142385882) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane.
Molecular Properties
| Compound Name | 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane |
| PubChem CID | 142385882 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane |
| SMILES | CC.CC.Cc1ccc(N2C(C)CNCC2C)cc1 |
| InChI | InChI=1S/C13H20N2.2C2H6/c1-10-4-6-13(7-5-10)15-11(2)8-14-9-12(15)3;2*1-2/h4-7,11-12,14H,8-9H2,1-3H3;2*1-2H3 |
| InChIKey | NUYYTBJQVLOBQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane?
The IUPAC name of 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane (CID 142385882) is 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane.
What is the SMILES notation for 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane?
The canonical SMILES for 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane is CC.CC.Cc1ccc(N2C(C)CNCC2C)cc1.
What is the InChIKey of 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane?
The InChIKey is NUYYTBJQVLOBQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.2C2H6/c1-10-4-6-13(7-5-10)15-11(2)8-14-9-12(15)3;2*1-2/h4-7,11-12,14H,8-9H2,1-3H3;2*1-2H3.
What are the key properties of 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane?
2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane has a molecular weight of 264.46 g/mol, XLogP of 4.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane is sourced from PubChem (CID 142385882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).