C17H32N2 — CID 142385882
2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane (PubChem CID 142385882) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane.
| Compound Name | 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane |
|---|---|
| PubChem CID | 142385882 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 2,6-dimethyl-1-(4-methylphenyl)piperazine;ethane |
| SMILES | CC.CC.Cc1ccc(N2C(C)CNCC2C)cc1 |
| InChI | InChI=1S/C13H20N2.2C2H6/c1-10-4-6-13(7-5-10)15-11(2)8-14-9-12(15)3;2*1-2/h4-7,11-12,14H,8-9H2,1-3H3;2*1-2H3 |
| InChIKey | NUYYTBJQVLOBQW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |