2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid

C13H17ClN2O2 — CID 99909309

IUPAC2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid
SMILESC[C@@H]1CNC[C@H](C)N1c1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C13H17ClN2O2/c1-8-6-15-7-9(2)16(8)10-3-4-11(13(17)18)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3,(H,17,18)/t8-,9+
InChIKeyYTEPRSNPKRUXNQ-DTORHVGOSA-N
MW268.74 g/mol
LogP2.22
Rot. Bonds2

About 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid

2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid (PubChem CID 99909309) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid.

Molecular Properties

Compound Name2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid
PubChem CID99909309
Molecular FormulaC13H17ClN2O2
Molecular Weight268.74 g/mol
Exact Mass268.10
IUPAC Name2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid
SMILESC[C@@H]1CNC[C@H](C)N1c1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C13H17ClN2O2/c1-8-6-15-7-9(2)16(8)10-3-4-11(13(17)18)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3,(H,17,18)/t8-,9+
InChIKeyYTEPRSNPKRUXNQ-DTORHVGOSA-N
XLogP2.22
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.74
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid?
The IUPAC name of 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid (CID 99909309) is 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid.
What is the SMILES notation for 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid?
The canonical SMILES for 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid is C[C@@H]1CNC[C@H](C)N1c1ccc(C(=O)O)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid?
The InChIKey is YTEPRSNPKRUXNQ-DTORHVGOSA-N. The full InChI is InChI=1S/C13H17ClN2O2/c1-8-6-15-7-9(2)16(8)10-3-4-11(13(17)18)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3,(H,17,18)/t8-,9+.
What are the key properties of 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid?
2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid has a molecular weight of 268.74 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid is sourced from PubChem (CID 99909309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).