C13H17ClN2O2 — CID 99909309
2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid (PubChem CID 99909309) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid.
| Compound Name | 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 99909309 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-chloro-4-[(2S,6R)-2,6-dimethylpiperazin-1-yl]benzoic acid |
| SMILES | C[C@@H]1CNC[C@H](C)N1c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-8-6-15-7-9(2)16(8)10-3-4-11(13(17)18)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3,(H,17,18)/t8-,9+ |
| InChIKey | YTEPRSNPKRUXNQ-DTORHVGOSA-N |
| XLogP | 2.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |