C25H28N8O — CID 170060553
3-ethyl-7-[[(1S,6R)-5-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]methyl]-1H-1,5-naphthyridin-2-one (PubChem CID 170060553) has the molecular formula C25H28N8O and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-ethyl-7-[[(1S,6R)-5-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]methyl]-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-ethyl-7-[[(1S,6R)-5-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]methyl]-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 170060553 |
| Molecular Formula | C25H28N8O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-ethyl-7-[[(1S,6R)-5-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]-2,5-diazabicyclo[4.2.0]octan-2-yl]methyl]-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(-c5n[nH]c(C)n5)nc4)[C@@H]4CC[C@@H]43)cc2[nH]c1=O |
| InChI | InChI=1S/C25H28N8O/c1-3-17-11-20-21(29-25(17)34)10-16(12-26-20)14-32-8-9-33(23-7-6-22(23)32)18-4-5-19(27-13-18)24-28-15(2)30-31-24/h4-5,10-13,22-23H,3,6-9,14H2,1-2H3,(H,29,34)(H,28,30,31)/t22-,23+/m0/s1 |
| InChIKey | ZSAAKXQVHMDJNL-XZOQPEGZSA-N |
| XLogP | 2.83 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |