C16H32N2 — CID 170063176
(1S,5R)-3,6-bis(3-methylbutyl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170063176) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (1S,5R)-3,6-bis(3-methylbutyl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3,6-bis(3-methylbutyl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170063176 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (1S,5R)-3,6-bis(3-methylbutyl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC(C)CCC1C[C@H]2CN(CCC(C)C)C[C@@H]1N2 |
| InChI | InChI=1S/C16H32N2/c1-12(2)5-6-14-9-15-10-18(8-7-13(3)4)11-16(14)17-15/h12-17H,5-11H2,1-4H3/t14?,15-,16-/m0/s1 |
| InChIKey | DDZQBIBWXWINNA-YVZMLIKISA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |