C12H26N2 — CID 145194084
(3R,5S)-3,5-dimethyl-1-(4-methylpentyl)piperazine (PubChem CID 145194084) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-1-(4-methylpentyl)piperazine.
| Compound Name | (3R,5S)-3,5-dimethyl-1-(4-methylpentyl)piperazine |
|---|---|
| PubChem CID | 145194084 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-1-(4-methylpentyl)piperazine |
| SMILES | CC(C)CCCN1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C12H26N2/c1-10(2)6-5-7-14-8-11(3)13-12(4)9-14/h10-13H,5-9H2,1-4H3/t11-,12+ |
| InChIKey | AOFYIWUHMYDIPX-TXEJJXNPSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |