About 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine
1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine (PubChem CID 68570113) has the molecular formula C20H44N4
and a molecular weight of 340.60 g/mol. Its IUPAC name is 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine |
| PubChem CID | 68570113 |
| Molecular Formula | C20H44N4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.36 |
| IUPAC Name | 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine |
| SMILES | CCC(C)N1CC(C)NC(C)C1.CCCCN1CC(C)NC(C)C1 |
| InChI | InChI=1S/2C10H22N2/c1-5-10(4)12-6-8(2)11-9(3)7-12;1-4-5-6-12-7-9(2)11-10(3)8-12/h8-11H,5-7H2,1-4H3;9-11H,4-8H2,1-3H3 |
| InChIKey | SRTXLMIPSQZHRX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine?
The IUPAC name of 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine (CID 68570113) is 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine.
What is the SMILES notation for 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine?
The canonical SMILES for 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine is CCC(C)N1CC(C)NC(C)C1.CCCCN1CC(C)NC(C)C1.
What is the InChIKey of 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine?
The InChIKey is SRTXLMIPSQZHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H22N2/c1-5-10(4)12-6-8(2)11-9(3)7-12;1-4-5-6-12-7-9(2)11-10(3)8-12/h8-11H,5-7H2,1-4H3;9-11H,4-8H2,1-3H3.
What are the key properties of 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine?
1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine has a molecular weight of 340.60 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-3,5-dimethylpiperazine;1-butyl-3,5-dimethylpiperazine is sourced from PubChem (CID 68570113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).