C21H22F5N3O — CID 170064731
N'-[1-(3,3-difluoro-1-methylcyclobutyl)-5-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2-oxo-4-pyridinyl]ethanimidamide (PubChem CID 170064731) has the molecular formula C21H22F5N3O and a molecular weight of 427.42 g/mol. Its IUPAC name is N'-[1-(3,3-difluoro-1-methylcyclobutyl)-5-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2-oxo-4-pyridinyl]ethanimidamide.
| Compound Name | N'-[1-(3,3-difluoro-1-methylcyclobutyl)-5-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2-oxo-4-pyridinyl]ethanimidamide |
|---|---|
| PubChem CID | 170064731 |
| Molecular Formula | C21H22F5N3O |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N'-[1-(3,3-difluoro-1-methylcyclobutyl)-5-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2-oxo-4-pyridinyl]ethanimidamide |
| SMILES | C/C(N)=N\c1cc(=O)n(C2(C)CC(F)(F)C2)cc1Cc1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C21H22F5N3O/c1-12-14(5-4-6-16(12)21(24,25)26)7-15-9-29(19(3)10-20(22,23)11-19)18(30)8-17(15)28-13(2)27/h4-6,8-9H,7,10-11H2,1-3H3,(H2,27,28) |
| InChIKey | RCMMBWDCFTZIHJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|