C22H20F4N4O2 — CID 170064964
4-[[3-(1,1-difluoroethyl)-2-fluorophenoxy]amino]-6-[(4R)-4-fluoro-2-bicyclo[3.1.1]heptanyl]pyrido[4,3-d]pyrimidin-7-one (PubChem CID 170064964) has the molecular formula C22H20F4N4O2 and a molecular weight of 448.42 g/mol. Its IUPAC name is 4-[[3-(1,1-difluoroethyl)-2-fluorophenoxy]amino]-6-[(4R)-4-fluoro-2-bicyclo[3.1.1]heptanyl]pyrido[4,3-d]pyrimidin-7-one.
| Compound Name | 4-[[3-(1,1-difluoroethyl)-2-fluorophenoxy]amino]-6-[(4R)-4-fluoro-2-bicyclo[3.1.1]heptanyl]pyrido[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170064964 |
| Molecular Formula | C22H20F4N4O2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[[3-(1,1-difluoroethyl)-2-fluorophenoxy]amino]-6-[(4R)-4-fluoro-2-bicyclo[3.1.1]heptanyl]pyrido[4,3-d]pyrimidin-7-one |
| SMILES | CC(F)(F)c1cccc(ONc2ncnc3cc(=O)n(C4C[C@@H](F)C5CC4C5)cc23)c1F |
| InChI | InChI=1S/C22H20F4N4O2/c1-22(25,26)14-3-2-4-18(20(14)24)32-29-21-13-9-30(19(31)8-16(13)27-10-28-21)17-7-15(23)11-5-12(17)6-11/h2-4,8-12,15,17H,5-7H2,1H3,(H,27,28,29)/t11?,12?,15-,17?/m1/s1 |
| InChIKey | CUCISHLVHFHKDZ-ZOQGINPYSA-N |
| XLogP | 4.76 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|