C39H58O5 — CID 170064967
[(5S,7R)-17-[(E,2R)-7-ethoxy-7-oxohept-5-en-2-yl]-3,10,13-trimethyl-3-propoxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 170064967) has the molecular formula C39H58O5 and a molecular weight of 606.89 g/mol. Its IUPAC name is [(5S,7R)-17-[(E,2R)-7-ethoxy-7-oxohept-5-en-2-yl]-3,10,13-trimethyl-3-propoxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(5S,7R)-17-[(E,2R)-7-ethoxy-7-oxohept-5-en-2-yl]-3,10,13-trimethyl-3-propoxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 170064967 |
| Molecular Formula | C39H58O5 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.43 |
| IUPAC Name | [(5S,7R)-17-[(E,2R)-7-ethoxy-7-oxohept-5-en-2-yl]-3,10,13-trimethyl-3-propoxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | CCCOC1(C)CCC2(C)C3CCC4(C)C(CCC4[C@H](C)CC/C=C/C(=O)OCC)C3C(OC(=O)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C39H58O5/c1-7-24-43-37(4)22-23-38(5)29(26-37)25-33(44-36(41)28-15-10-9-11-16-28)35-31-19-18-30(39(31,6)21-20-32(35)38)27(3)14-12-13-17-34(40)42-8-2/h9-11,13,15-17,27,29-33,35H,7-8,12,14,18-26H2,1-6H3/b17-13+/t27-,29+,30?,31?,32?,33?,35?,37?,38?,39?/m1/s1 |
| InChIKey | QHPUBZKDTASQTR-LDODPPBHSA-N |
| XLogP | 9.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|