C16H34O2 — CID 170068950
2,4-diethyl-6-(methoxymethyl)-3,5-dimethyloctan-1-ol (PubChem CID 170068950) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2,4-diethyl-6-(methoxymethyl)-3,5-dimethyloctan-1-ol.
| Compound Name | 2,4-diethyl-6-(methoxymethyl)-3,5-dimethyloctan-1-ol |
|---|---|
| PubChem CID | 170068950 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 2,4-diethyl-6-(methoxymethyl)-3,5-dimethyloctan-1-ol |
| SMILES | CCC(CO)C(C)C(CC)C(C)C(CC)COC |
| InChI | InChI=1S/C16H34O2/c1-7-14(10-17)12(4)16(9-3)13(5)15(8-2)11-18-6/h12-17H,7-11H2,1-6H3 |
| InChIKey | XUWYIKCVKCDHHN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |