C29H28F6NO9P — CID 170070585
(2S)-2-amino-3-[3-[3-[2-[4-[3,5-bis(trifluoromethyl)phenyl]phenoxy]phenyl]propanoyloxy]propoxy-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 170070585) has the molecular formula C29H28F6NO9P and a molecular weight of 679.50 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-[3-[2-[4-[3,5-bis(trifluoromethyl)phenyl]phenoxy]phenyl]propanoyloxy]propoxy-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[3-[3-[2-[4-[3,5-bis(trifluoromethyl)phenyl]phenoxy]phenyl]propanoyloxy]propoxy-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 170070585 |
| Molecular Formula | C29H28F6NO9P |
| Molecular Weight | 679.50 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | (2S)-2-amino-3-[3-[3-[2-[4-[3,5-bis(trifluoromethyl)phenyl]phenoxy]phenyl]propanoyloxy]propoxy-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | N[C@@H](COP(=O)(O)OCCCOC(=O)CCc1ccccc1Oc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C29H28F6NO9P/c30-28(31,32)21-14-20(15-22(16-21)29(33,34)35)18-6-9-23(10-7-18)45-25-5-2-1-4-19(25)8-11-26(37)42-12-3-13-43-46(40,41)44-17-24(36)27(38)39/h1-2,4-7,9-10,14-16,24H,3,8,11-13,17,36H2,(H,38,39)(H,40,41)/t24-/m0/s1 |
| InChIKey | RRMOKLGECJLLNZ-DEOSSOPVSA-N |
| XLogP | 6.59 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|