C22H36NO10P — CID 71042485
(2S)-2-amino-3-[[(2R)-3-[3-(2-heptan-2-yloxyphenyl)propanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 71042485) has the molecular formula C22H36NO10P and a molecular weight of 505.50 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-3-[3-(2-heptan-2-yloxyphenyl)propanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-3-[3-(2-heptan-2-yloxyphenyl)propanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 71042485 |
| Molecular Formula | C22H36NO10P |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-3-[3-(2-heptan-2-yloxyphenyl)propanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCC(C)Oc1ccccc1CCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C22H36NO10P/c1-3-4-5-8-16(2)33-20-10-7-6-9-17(20)11-12-21(25)30-13-18(24)14-31-34(28,29)32-15-19(23)22(26)27/h6-7,9-10,16,18-19,24H,3-5,8,11-15,23H2,1-2H3,(H,26,27)(H,28,29)/t16?,18-,19+/m1/s1 |
| InChIKey | WEELNWLCLLWXPI-VITQDTLGSA-N |
| XLogP | 2.42 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|