C13H27N3O2 — CID 170071630
2-(dimethylamino)-N-[3-[formyl(methyl)amino]-2,3-dimethylbutan-2-yl]propanamide (PubChem CID 170071630) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[formyl(methyl)amino]-2,3-dimethylbutan-2-yl]propanamide.
| Compound Name | 2-(dimethylamino)-N-[3-[formyl(methyl)amino]-2,3-dimethylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 170071630 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[formyl(methyl)amino]-2,3-dimethylbutan-2-yl]propanamide |
| SMILES | CC(C(=O)NC(C)(C)C(C)(C)N(C)C=O)N(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-10(15(6)7)11(18)14-12(2,3)13(4,5)16(8)9-17/h9-10H,1-8H3,(H,14,18) |
| InChIKey | RRLJLQNPZNRFAZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|