C15H28N2O2 — CID 129012998
(2S)-N-[2-(1-deuterio-2-methyl-1-oxopropan-2-yl)cyclohexyl]-2-(dimethylamino)propanamide (PubChem CID 129012998) has the molecular formula C15H28N2O2 and a molecular weight of 269.41 g/mol. Its IUPAC name is (2S)-N-[2-(1-deuterio-2-methyl-1-oxopropan-2-yl)cyclohexyl]-2-(dimethylamino)propanamide.
| Compound Name | (2S)-N-[2-(1-deuterio-2-methyl-1-oxopropan-2-yl)cyclohexyl]-2-(dimethylamino)propanamide |
|---|---|
| PubChem CID | 129012998 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (2S)-N-[2-(1-deuterio-2-methyl-1-oxopropan-2-yl)cyclohexyl]-2-(dimethylamino)propanamide |
| SMILES | [2H]C(=O)C(C)(C)C1CCCCC1NC(=O)[C@H](C)N(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-11(17(4)5)14(19)16-13-9-7-6-8-12(13)15(2,3)10-18/h10-13H,6-9H2,1-5H3,(H,16,19)/t11-,12?,13?/m0/s1/i10D |
| InChIKey | FLDIMYWIUJGALV-FPFVGCFPSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|