C29H31N3O2S — CID 170071960
ethyl 5-cyclohexyl-2-[(diaminomethylideneamino)methyl]-6-naphthalen-1-yl-1-benzothiophene-3-carboxylate (PubChem CID 170071960) has the molecular formula C29H31N3O2S and a molecular weight of 485.65 g/mol. Its IUPAC name is ethyl 5-cyclohexyl-2-[(diaminomethylideneamino)methyl]-6-naphthalen-1-yl-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 5-cyclohexyl-2-[(diaminomethylideneamino)methyl]-6-naphthalen-1-yl-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 170071960 |
| Molecular Formula | C29H31N3O2S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | ethyl 5-cyclohexyl-2-[(diaminomethylideneamino)methyl]-6-naphthalen-1-yl-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN=C(N)N)sc2cc(-c3cccc4ccccc34)c(C3CCCCC3)cc12 |
| InChI | InChI=1S/C29H31N3O2S/c1-2-34-28(33)27-24-15-22(19-9-4-3-5-10-19)23(16-25(24)35-26(27)17-32-29(30)31)21-14-8-12-18-11-6-7-13-20(18)21/h6-8,11-16,19H,2-5,9-10,17H2,1H3,(H4,30,31,32) |
| InChIKey | HPHWQCNAHACPTN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|