C28H23NO3S — CID 170077109
ethyl 2-(aminomethyl)-6-naphthalen-1-yl-5-phenoxy-1-benzothiophene-3-carboxylate (PubChem CID 170077109) has the molecular formula C28H23NO3S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6-naphthalen-1-yl-5-phenoxy-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-6-naphthalen-1-yl-5-phenoxy-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 170077109 |
| Molecular Formula | C28H23NO3S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 2-(aminomethyl)-6-naphthalen-1-yl-5-phenoxy-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN)sc2cc(-c3cccc4ccccc34)c(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C28H23NO3S/c1-2-31-28(30)27-23-15-24(32-19-11-4-3-5-12-19)22(16-25(23)33-26(27)17-29)21-14-8-10-18-9-6-7-13-20(18)21/h3-16H,2,17,29H2,1H3 |
| InChIKey | XOWXKPWDBSCIFZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |