C48H40IN — CID 170072056
9-(4-iodo-3,5-diphenylphenyl)-3,6-bis(2-phenylpropan-2-yl)carbazole (PubChem CID 170072056) has the molecular formula C48H40IN and a molecular weight of 757.76 g/mol. Its IUPAC name is 9-(4-iodo-3,5-diphenylphenyl)-3,6-bis(2-phenylpropan-2-yl)carbazole.
| Compound Name | 9-(4-iodo-3,5-diphenylphenyl)-3,6-bis(2-phenylpropan-2-yl)carbazole |
|---|---|
| PubChem CID | 170072056 |
| Molecular Formula | C48H40IN |
| Molecular Weight | 757.76 g/mol |
| Exact Mass | 757.22 |
| IUPAC Name | 9-(4-iodo-3,5-diphenylphenyl)-3,6-bis(2-phenylpropan-2-yl)carbazole |
| SMILES | CC(C)(c1ccccc1)c1ccc2c(c1)c1cc(C(C)(C)c3ccccc3)ccc1n2-c1cc(-c2ccccc2)c(I)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C48H40IN/c1-47(2,35-21-13-7-14-22-35)37-25-27-44-42(29-37)43-30-38(48(3,4)36-23-15-8-16-24-36)26-28-45(43)50(44)39-31-40(33-17-9-5-10-18-33)46(49)41(32-39)34-19-11-6-12-20-34/h5-32H,1-4H3 |
| InChIKey | YTDYGLNGJNIHAY-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.76 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|