C24H30N4O2 — CID 17007228
N-[[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-methylbenzamide (PubChem CID 17007228) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-methylbenzamide.
| Compound Name | N-[[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 17007228 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-4-methylbenzamide |
| SMILES | CCCN(CCC)C(=O)Cn1c(CNC(=O)c2ccc(C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C24H30N4O2/c1-4-14-27(15-5-2)23(29)17-28-21-9-7-6-8-20(21)26-22(28)16-25-24(30)19-12-10-18(3)11-13-19/h6-13H,4-5,14-17H2,1-3H3,(H,25,30) |
| InChIKey | SQHRANBCTZCWRI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |