C18H22BrFN2O2 — CID 170072717
tert-butyl 4-[2-(2-amino-4-bromo-6-fluorophenyl)ethynyl]piperidine-1-carboxylate (PubChem CID 170072717) has the molecular formula C18H22BrFN2O2 and a molecular weight of 397.29 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-amino-4-bromo-6-fluorophenyl)ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-amino-4-bromo-6-fluorophenyl)ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170072717 |
| Molecular Formula | C18H22BrFN2O2 |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | tert-butyl 4-[2-(2-amino-4-bromo-6-fluorophenyl)ethynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#Cc2c(N)cc(Br)cc2F)CC1 |
| InChI | InChI=1S/C18H22BrFN2O2/c1-18(2,3)24-17(23)22-8-6-12(7-9-22)4-5-14-15(20)10-13(19)11-16(14)21/h10-12H,6-9,21H2,1-3H3 |
| InChIKey | DRJWKDFZYMJWRB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|