C16H21ClN4O2 — CID 166104382
tert-butyl 4-[2-(3-amino-6-chloropyrazin-2-yl)ethynyl]piperidine-1-carboxylate (PubChem CID 166104382) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-amino-6-chloropyrazin-2-yl)ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-amino-6-chloropyrazin-2-yl)ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166104382 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | tert-butyl 4-[2-(3-amino-6-chloropyrazin-2-yl)ethynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#Cc2nc(Cl)cnc2N)CC1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-16(2,3)23-15(22)21-8-6-11(7-9-21)4-5-12-14(18)19-10-13(17)20-12/h10-11H,6-9H2,1-3H3,(H2,18,19) |
| InChIKey | VAQRJCCQTLLVFC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|