C11H17F2IN2O — CID 170075717
(4-fluorocyclohexyl)-[(3S,4R)-3-fluoro-4-(iodoamino)pyrrolidin-1-yl]methanone (PubChem CID 170075717) has the molecular formula C11H17F2IN2O and a molecular weight of 358.17 g/mol. Its IUPAC name is (4-fluorocyclohexyl)-[(3S,4R)-3-fluoro-4-(iodoamino)pyrrolidin-1-yl]methanone.
| Compound Name | (4-fluorocyclohexyl)-[(3S,4R)-3-fluoro-4-(iodoamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 170075717 |
| Molecular Formula | C11H17F2IN2O |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (4-fluorocyclohexyl)-[(3S,4R)-3-fluoro-4-(iodoamino)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCC(F)CC1)N1C[C@H](F)[C@H](NI)C1 |
| InChI | InChI=1S/C11H17F2IN2O/c12-8-3-1-7(2-4-8)11(17)16-5-9(13)10(6-16)15-14/h7-10,15H,1-6H2/t7?,8?,9-,10+/m0/s1 |
| InChIKey | HCMGZXOGQRAMBF-HORUIINNSA-N |
| XLogP | 2.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|