C35H39N3O2 — CID 170077724
N-[2-(7,7,9-triphenylnonanoylamino)ethyl]pyridine-3-carboxamide (PubChem CID 170077724) has the molecular formula C35H39N3O2 and a molecular weight of 533.72 g/mol. Its IUPAC name is N-[2-(7,7,9-triphenylnonanoylamino)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(7,7,9-triphenylnonanoylamino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170077724 |
| Molecular Formula | C35H39N3O2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | N-[2-(7,7,9-triphenylnonanoylamino)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(CCCCCC(CCc1ccccc1)(c1ccccc1)c1ccccc1)NCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C35H39N3O2/c39-33(37-26-27-38-34(40)30-16-13-25-36-28-30)21-11-4-12-23-35(31-17-7-2-8-18-31,32-19-9-3-10-20-32)24-22-29-14-5-1-6-15-29/h1-3,5-10,13-20,25,28H,4,11-12,21-24,26-27H2,(H,37,39)(H,38,40) |
| InChIKey | OGXBDOWHFIIMLR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|