C10H12FI2NO — CID 170080939
1-(3-fluoro-5-methoxyphenyl)-N,N-bis(iodomethyl)methanamine (PubChem CID 170080939) has the molecular formula C10H12FI2NO and a molecular weight of 435.02 g/mol. Its IUPAC name is 1-(3-fluoro-5-methoxyphenyl)-N,N-bis(iodomethyl)methanamine.
| Compound Name | 1-(3-fluoro-5-methoxyphenyl)-N,N-bis(iodomethyl)methanamine |
|---|---|
| PubChem CID | 170080939 |
| Molecular Formula | C10H12FI2NO |
| Molecular Weight | 435.02 g/mol |
| Exact Mass | 434.90 |
| IUPAC Name | 1-(3-fluoro-5-methoxyphenyl)-N,N-bis(iodomethyl)methanamine |
| SMILES | COc1cc(F)cc(CN(CI)CI)c1 |
| InChI | InChI=1S/C10H12FI2NO/c1-15-10-3-8(2-9(11)4-10)5-14(6-12)7-13/h2-4H,5-7H2,1H3 |
| InChIKey | FTIKQNYTKUYJFS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|