C8H10FNO3S — CID 165443567
(3-fluoro-5-methoxyphenyl)methanesulfonamide (PubChem CID 165443567) has the molecular formula C8H10FNO3S and a molecular weight of 219.24 g/mol. Its IUPAC name is (3-fluoro-5-methoxyphenyl)methanesulfonamide.
| Compound Name | (3-fluoro-5-methoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 165443567 |
| Molecular Formula | C8H10FNO3S |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | (3-fluoro-5-methoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(F)cc(CS(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H10FNO3S/c1-13-8-3-6(2-7(9)4-8)5-14(10,11)12/h2-4H,5H2,1H3,(H2,10,11,12) |
| InChIKey | UGVYDUIBYSPYIG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |