C23H24F4N2O2 — CID 170081458
8-[3-(2-fluorophenyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-2-yl]-2-hydroxy-2-methyloctan-4-one (PubChem CID 170081458) has the molecular formula C23H24F4N2O2 and a molecular weight of 436.45 g/mol. Its IUPAC name is 8-[3-(2-fluorophenyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-2-yl]-2-hydroxy-2-methyloctan-4-one.
| Compound Name | 8-[3-(2-fluorophenyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-2-yl]-2-hydroxy-2-methyloctan-4-one |
|---|---|
| PubChem CID | 170081458 |
| Molecular Formula | C23H24F4N2O2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 8-[3-(2-fluorophenyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyridin-2-yl]-2-hydroxy-2-methyloctan-4-one |
| SMILES | CC(C)(O)CC(=O)CCCCc1nn2ccc(C(F)(F)F)cc2c1-c1ccccc1F |
| InChI | InChI=1S/C23H24F4N2O2/c1-22(2,31)14-16(30)7-3-6-10-19-21(17-8-4-5-9-18(17)24)20-13-15(23(25,26)27)11-12-29(20)28-19/h4-5,8-9,11-13,31H,3,6-7,10,14H2,1-2H3 |
| InChIKey | RQFLYNQYEGAYFA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|