C24H33F3N2O2 — CID 139518442
2-cyclopropyl-8-[6-(2-hydroxypropan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]-2-methyloctan-4-one (PubChem CID 139518442) has the molecular formula C24H33F3N2O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-cyclopropyl-8-[6-(2-hydroxypropan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]-2-methyloctan-4-one.
| Compound Name | 2-cyclopropyl-8-[6-(2-hydroxypropan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]-2-methyloctan-4-one |
|---|---|
| PubChem CID | 139518442 |
| Molecular Formula | C24H33F3N2O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-cyclopropyl-8-[6-(2-hydroxypropan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazol-2-yl]-2-methyloctan-4-one |
| SMILES | CC(C)(O)c1ccc2nc(CCCCC(=O)CC(C)(C)C3CC3)n(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C24H33F3N2O2/c1-22(2,16-9-10-16)14-18(30)7-5-6-8-21-28-19-12-11-17(23(3,4)31)13-20(19)29(21)15-24(25,26)27/h11-13,16,31H,5-10,14-15H2,1-4H3 |
| InChIKey | YCESQFXEAWNCEX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|