C27H30FN3O2 — CID 139518213
2-[(7R)-7-(4-fluorophenyl)-7-hydroxy-5-oxooctyl]-3-(1-methylcyclobutyl)benzimidazole-5-carbonitrile (PubChem CID 139518213) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-[(7R)-7-(4-fluorophenyl)-7-hydroxy-5-oxooctyl]-3-(1-methylcyclobutyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[(7R)-7-(4-fluorophenyl)-7-hydroxy-5-oxooctyl]-3-(1-methylcyclobutyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 139518213 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[(7R)-7-(4-fluorophenyl)-7-hydroxy-5-oxooctyl]-3-(1-methylcyclobutyl)benzimidazole-5-carbonitrile |
| SMILES | CC1(n2c(CCCCC(=O)C[C@@](C)(O)c3ccc(F)cc3)nc3ccc(C#N)cc32)CCC1 |
| InChI | InChI=1S/C27H30FN3O2/c1-26(14-5-15-26)31-24-16-19(18-29)8-13-23(24)30-25(31)7-4-3-6-22(32)17-27(2,33)20-9-11-21(28)12-10-20/h8-13,16,33H,3-7,14-15,17H2,1-2H3/t27-/m1/s1 |
| InChIKey | BFFZCOJEIRPHPR-HHHXNRCGSA-N |
| XLogP | 5.53 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|