C23H30F2N2O2 — CID 139518573
2-cyclopropyl-8-[5,6-difluoro-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-hydroxyoctan-4-one (PubChem CID 139518573) has the molecular formula C23H30F2N2O2 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-cyclopropyl-8-[5,6-difluoro-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-hydroxyoctan-4-one.
| Compound Name | 2-cyclopropyl-8-[5,6-difluoro-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-hydroxyoctan-4-one |
|---|---|
| PubChem CID | 139518573 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-cyclopropyl-8-[5,6-difluoro-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-hydroxyoctan-4-one |
| SMILES | CC(O)(CC(=O)CCCCc1nc2cc(F)c(F)cc2n1C1(C)CCC1)C1CC1 |
| InChI | InChI=1S/C23H30F2N2O2/c1-22(10-5-11-22)27-20-13-18(25)17(24)12-19(20)26-21(27)7-4-3-6-16(28)14-23(2,29)15-8-9-15/h12-13,15,29H,3-11,14H2,1-2H3 |
| InChIKey | GVJZZGCFEFCUHZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|