C26H25BrClN3O2 — CID 17008170
3-bromo-N-[[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17008170) has the molecular formula C26H25BrClN3O2 and a molecular weight of 526.86 g/mol. Its IUPAC name is 3-bromo-N-[[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 3-bromo-N-[[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17008170 |
| Molecular Formula | C26H25BrClN3O2 |
| Molecular Weight | 526.86 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 3-bromo-N-[[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | Cc1cc(OCCCCn2c(CNC(=O)c3cccc(Br)c3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C26H25BrClN3O2/c1-18-15-21(11-12-22(18)28)33-14-5-4-13-31-24-10-3-2-9-23(24)30-25(31)17-29-26(32)19-7-6-8-20(27)16-19/h2-3,6-12,15-16H,4-5,13-14,17H2,1H3,(H,29,32) |
| InChIKey | FJTPQILNUOHNEN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|