C21H21F3N6O2 — CID 170083041
[5-(benzimidazole-1-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(1,4-oxazepan-4-yl)methanone (PubChem CID 170083041) has the molecular formula C21H21F3N6O2 and a molecular weight of 446.43 g/mol. Its IUPAC name is [5-(benzimidazole-1-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(1,4-oxazepan-4-yl)methanone.
| Compound Name | [5-(benzimidazole-1-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 170083041 |
| Molecular Formula | C21H21F3N6O2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [5-(benzimidazole-1-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(1,4-oxazepan-4-yl)methanone |
| SMILES | [H]/N=C(/c1cnc(C(=O)N2CCCOCC2)cc1NCC(F)(F)F)n1cnc2ccccc21 |
| InChI | InChI=1S/C21H21F3N6O2/c22-21(23,24)12-27-16-10-17(20(31)29-6-3-8-32-9-7-29)26-11-14(16)19(25)30-13-28-15-4-1-2-5-18(15)30/h1-2,4-5,10-11,13,25H,3,6-9,12H2,(H,26,27)/b25-19- |
| InChIKey | VZNBFQQHEJQEOP-PLRJNAJWSA-N |
| XLogP | 3.14 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|