C21H19F5N6O3 — CID 170082822
[5-(6,8-difluoroimidazo[1,2-a]pyridine-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(6-hydroxy-1,4-oxazepan-4-yl)methanone (PubChem CID 170082822) has the molecular formula C21H19F5N6O3 and a molecular weight of 498.41 g/mol. Its IUPAC name is [5-(6,8-difluoroimidazo[1,2-a]pyridine-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(6-hydroxy-1,4-oxazepan-4-yl)methanone.
| Compound Name | [5-(6,8-difluoroimidazo[1,2-a]pyridine-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(6-hydroxy-1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 170082822 |
| Molecular Formula | C21H19F5N6O3 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [5-(6,8-difluoroimidazo[1,2-a]pyridine-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)-2-pyridinyl]-(6-hydroxy-1,4-oxazepan-4-yl)methanone |
| SMILES | [H]/N=C(\c1cnc(C(=O)N2CCOCC(O)C2)cc1NCC(F)(F)F)c1cnc2c(F)cc(F)cn12 |
| InChI | InChI=1S/C21H19F5N6O3/c22-11-3-14(23)19-29-6-17(32(19)7-11)18(27)13-5-28-16(4-15(13)30-10-21(24,25)26)20(34)31-1-2-35-9-12(33)8-31/h3-7,12,27,33H,1-2,8-10H2,(H,28,30)/b27-18+ |
| InChIKey | YHNQUXGJPGIDCG-OVVQPSECSA-N |
| XLogP | 2.23 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|