C27H25ClN4O4 — CID 170083866
N-[3-(2-chloro-4-phenoxybenzoyl)-4-[(3-hydroxy-1-methylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]formamide (PubChem CID 170083866) has the molecular formula C27H25ClN4O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-[3-(2-chloro-4-phenoxybenzoyl)-4-[(3-hydroxy-1-methylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]formamide.
| Compound Name | N-[3-(2-chloro-4-phenoxybenzoyl)-4-[(3-hydroxy-1-methylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]formamide |
|---|---|
| PubChem CID | 170083866 |
| Molecular Formula | C27H25ClN4O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[3-(2-chloro-4-phenoxybenzoyl)-4-[(3-hydroxy-1-methylcyclopentyl)amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]formamide |
| SMILES | CC1(Nc2c(NC=O)cnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4Cl)c23)CCC(O)C1 |
| InChI | InChI=1S/C27H25ClN4O4/c1-27(10-9-16(34)12-27)32-24-22(31-15-33)14-30-26-23(24)20(13-29-26)25(35)19-8-7-18(11-21(19)28)36-17-5-3-2-4-6-17/h2-8,11,13-16,34H,9-10,12H2,1H3,(H,31,33)(H2,29,30,32) |
| InChIKey | HORBFOQZEPXIEM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|