C12H17F2NO2 — CID 170084495
N-butyl-2-[(1E,3E)-4,5-difluorohexa-1,3,5-trienoxy]acetamide (PubChem CID 170084495) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is N-butyl-2-[(1E,3E)-4,5-difluorohexa-1,3,5-trienoxy]acetamide.
| Compound Name | N-butyl-2-[(1E,3E)-4,5-difluorohexa-1,3,5-trienoxy]acetamide |
|---|---|
| PubChem CID | 170084495 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-butyl-2-[(1E,3E)-4,5-difluorohexa-1,3,5-trienoxy]acetamide |
| SMILES | C=C(F)/C(F)=C\C=C\OCC(=O)NCCCC |
| InChI | InChI=1S/C12H17F2NO2/c1-3-4-7-15-12(16)9-17-8-5-6-11(14)10(2)13/h5-6,8H,2-4,7,9H2,1H3,(H,15,16)/b8-5+,11-6+ |
| InChIKey | KQCMJSIQHUXPDY-XSIURBDDSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|