C10H17NO2 — CID 177046936
2-methoxy-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]acetamide (PubChem CID 177046936) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-methoxy-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]acetamide.
| Compound Name | 2-methoxy-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 177046936 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-methoxy-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]acetamide |
| SMILES | C/C=C\C=C(/C)CNC(=O)COC |
| InChI | InChI=1S/C10H17NO2/c1-4-5-6-9(2)7-11-10(12)8-13-3/h4-6H,7-8H2,1-3H3,(H,11,12)/b5-4-,9-6+ |
| InChIKey | BNYGXVFYKJMLER-KMOPYBJPSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|