C30H35N3O4 — CID 17008460
N-[[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 17008460) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17008460 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | CCC(C)c1ccc(OCCCn2c(CNC(=O)c3ccc(OC)c(OC)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H35N3O4/c1-5-21(2)22-11-14-24(15-12-22)37-18-8-17-33-26-10-7-6-9-25(26)32-29(33)20-31-30(34)23-13-16-27(35-3)28(19-23)36-4/h6-7,9-16,19,21H,5,8,17-18,20H2,1-4H3,(H,31,34) |
| InChIKey | PTNWLZUYMCIPTP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|