C20H19ClN4O4 — CID 170084642
3-(2-chlorobenzoyl)-10-(2-hydroxyethyl)-12-(methoxymethyl)-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one (PubChem CID 170084642) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is 3-(2-chlorobenzoyl)-10-(2-hydroxyethyl)-12-(methoxymethyl)-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one.
| Compound Name | 3-(2-chlorobenzoyl)-10-(2-hydroxyethyl)-12-(methoxymethyl)-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 170084642 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-(2-chlorobenzoyl)-10-(2-hydroxyethyl)-12-(methoxymethyl)-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
| SMILES | COCC1Nc2c(cnc3[nH]cc(C(=O)c4ccccc4Cl)c23)N(CCO)C1=O |
| InChI | InChI=1S/C20H19ClN4O4/c1-29-10-14-20(28)25(6-7-26)15-9-23-19-16(17(15)24-14)12(8-22-19)18(27)11-4-2-3-5-13(11)21/h2-5,8-9,14,24,26H,6-7,10H2,1H3,(H,22,23) |
| InChIKey | QGODCLQOTDFFNE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |