C19H17IN4O3 — CID 170084521
(12S)-3-(2-iodobenzoyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one (PubChem CID 170084521) has the molecular formula C19H17IN4O3 and a molecular weight of 476.27 g/mol. Its IUPAC name is (12S)-3-(2-iodobenzoyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one.
| Compound Name | (12S)-3-(2-iodobenzoyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 170084521 |
| Molecular Formula | C19H17IN4O3 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | (12S)-3-(2-iodobenzoyl)-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
| SMILES | COC[C@]1(C)Nc2c(cnc3[nH]cc(C(=O)c4ccccc4I)c23)NC1=O |
| InChI | InChI=1S/C19H17IN4O3/c1-19(9-27-2)18(26)23-13-8-22-17-14(15(13)24-19)11(7-21-17)16(25)10-5-3-4-6-12(10)20/h3-8,24H,9H2,1-2H3,(H,21,22)(H,23,26)/t19-/m0/s1 |
| InChIKey | FUZKAUJWNUJGLL-IBGZPJMESA-N |
| XLogP | 3.17 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|