C19H19ClN4O2S — CID 163217439
(12S)-3-[(2-chlorophenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-11-thione (PubChem CID 163217439) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is (12S)-3-[(2-chlorophenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-11-thione.
| Compound Name | (12S)-3-[(2-chlorophenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-11-thione |
|---|---|
| PubChem CID | 163217439 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (12S)-3-[(2-chlorophenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-11-thione |
| SMILES | COC[C@]1(C)Nc2c(cnc3[nH]cc(C(O)c4ccccc4Cl)c23)NC1=S |
| InChI | InChI=1S/C19H19ClN4O2S/c1-19(9-26-2)18(27)23-13-8-22-17-14(15(13)24-19)11(7-21-17)16(25)10-5-3-4-6-12(10)20/h3-8,16,24-25H,9H2,1-2H3,(H,21,22)(H,23,27)/t16?,19-/m0/s1 |
| InChIKey | DQEIPYJGQCRELC-CVMIBEPCSA-N |
| XLogP | 3.87 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|