C25H23ClN4O4 — CID 170083531
(12S)-3-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one (PubChem CID 170083531) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is (12S)-3-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one.
| Compound Name | (12S)-3-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 170083531 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (12S)-3-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-11-one |
| SMILES | COC[C@]1(C)Nc2c(cnc3[nH]cc(C(O)c4ccc(Oc5ccccc5)cc4Cl)c23)NC1=O |
| InChI | InChI=1S/C25H23ClN4O4/c1-25(13-33-2)24(32)29-19-12-28-23-20(21(19)30-25)17(11-27-23)22(31)16-9-8-15(10-18(16)26)34-14-6-4-3-5-7-14/h3-12,22,30-31H,13H2,1-2H3,(H,27,28)(H,29,32)/t22?,25-/m0/s1 |
| InChIKey | ILEPPHDSCPUQRC-TUXUZCGSSA-N |
| XLogP | 4.86 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |