C20H23ClN4O3 — CID 175902626
(2-chloro-4-methoxyphenyl)-[12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-3-yl]methanol (PubChem CID 175902626) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (2-chloro-4-methoxyphenyl)-[12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-3-yl]methanol.
| Compound Name | (2-chloro-4-methoxyphenyl)-[12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-3-yl]methanol |
|---|---|
| PubChem CID | 175902626 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2-chloro-4-methoxyphenyl)-[12-(methoxymethyl)-12-methyl-5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-3-yl]methanol |
| SMILES | COCC1(C)CNc2cnc3[nH]cc(C(O)c4ccc(OC)cc4Cl)c3c2N1 |
| InChI | InChI=1S/C20H23ClN4O3/c1-20(10-27-2)9-24-15-8-23-19-16(17(15)25-20)13(7-22-19)18(26)12-5-4-11(28-3)6-14(12)21/h4-8,18,24-26H,9-10H2,1-3H3,(H,22,23) |
| InChIKey | LRLVLSXIZGZKNV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |