C24H20ClN3O3 — CID 163362966
12-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-4,4-dimethyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one (PubChem CID 163362966) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is 12-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-4,4-dimethyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one.
| Compound Name | 12-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-4,4-dimethyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
|---|---|
| PubChem CID | 163362966 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 12-[(2-chloro-4-phenoxyphenyl)-hydroxymethyl]-4,4-dimethyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
| SMILES | CC1(C)Nc2c(cnc3[nH]cc(C(O)c4ccc(Oc5ccccc5)cc4Cl)c23)C1=O |
| InChI | InChI=1S/C24H20ClN3O3/c1-24(2)22(30)17-12-27-23-19(20(17)28-24)16(11-26-23)21(29)15-9-8-14(10-18(15)25)31-13-6-4-3-5-7-13/h3-12,21,28-29H,1-2H3,(H,26,27) |
| InChIKey | MDBZWUUAZGUISF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |