C9H19N2+ — CID 170085709
N,1-dimethyl-1-propan-2-ylpyrrolidin-1-ium-2-imine (PubChem CID 170085709) has the molecular formula C9H19N2+ and a molecular weight of 155.26 g/mol. Its IUPAC name is N,1-dimethyl-1-propan-2-ylpyrrolidin-1-ium-2-imine.
| Compound Name | N,1-dimethyl-1-propan-2-ylpyrrolidin-1-ium-2-imine |
|---|---|
| PubChem CID | 170085709 |
| Molecular Formula | C9H19N2+ |
| Molecular Weight | 155.26 g/mol |
| Exact Mass | 155.15 |
| IUPAC Name | N,1-dimethyl-1-propan-2-ylpyrrolidin-1-ium-2-imine |
| SMILES | C/N=C1\CCC[N+]1(C)C(C)C |
| InChI | InChI=1S/C9H19N2/c1-8(2)11(4)7-5-6-9(11)10-3/h8H,5-7H2,1-4H3/q+1/b10-9+ |
| InChIKey | KCMKFVQWIVRSDI-MDZDMXLPSA-N |
| XLogP | 1.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|