C10H16O2 — CID 170088260
(3S)-3-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]oxolane (PubChem CID 170088260) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3S)-3-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]oxolane.
| Compound Name | (3S)-3-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]oxolane |
|---|---|
| PubChem CID | 170088260 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3S)-3-[[(3E)-penta-1,3-dien-3-yl]oxymethyl]oxolane |
| SMILES | C=C/C(=C\C)OC[C@H]1CCOC1 |
| InChI | InChI=1S/C10H16O2/c1-3-10(4-2)12-8-9-5-6-11-7-9/h3-4,9H,1,5-8H2,2H3/b10-4+/t9-/m0/s1 |
| InChIKey | OECUGQPSGABNBX-YNYSXPKMSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|