C20H21N7OS — CID 170090401
4-(cyclopropylamino)-6-(1,6-naphthyridin-2-ylamino)-N-(1-sulfanylazetidin-3-yl)pyridine-3-carboxamide (PubChem CID 170090401) has the molecular formula C20H21N7OS and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-(cyclopropylamino)-6-(1,6-naphthyridin-2-ylamino)-N-(1-sulfanylazetidin-3-yl)pyridine-3-carboxamide.
| Compound Name | 4-(cyclopropylamino)-6-(1,6-naphthyridin-2-ylamino)-N-(1-sulfanylazetidin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170090401 |
| Molecular Formula | C20H21N7OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-(cyclopropylamino)-6-(1,6-naphthyridin-2-ylamino)-N-(1-sulfanylazetidin-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CN(S)C1)c1cnc(Nc2ccc3cnccc3n2)cc1NC1CC1 |
| InChI | InChI=1S/C20H21N7OS/c28-20(24-14-10-27(29)11-14)15-9-22-19(7-17(15)23-13-2-3-13)26-18-4-1-12-8-21-6-5-16(12)25-18/h1,4-9,13-14,29H,2-3,10-11H2,(H,24,28)(H2,22,23,25,26) |
| InChIKey | GPZVOSNSZOLHQX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|