C24H22F2N6O3 — CID 170094310
5-amino-1-(3-amino-3-hydroxycyclobutyl)-3-[4-(difluoromethoxy)-2-phenylquinolin-7-yl]pyrazole-4-carboxamide (PubChem CID 170094310) has the molecular formula C24H22F2N6O3 and a molecular weight of 480.48 g/mol. Its IUPAC name is 5-amino-1-(3-amino-3-hydroxycyclobutyl)-3-[4-(difluoromethoxy)-2-phenylquinolin-7-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(3-amino-3-hydroxycyclobutyl)-3-[4-(difluoromethoxy)-2-phenylquinolin-7-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170094310 |
| Molecular Formula | C24H22F2N6O3 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 5-amino-1-(3-amino-3-hydroxycyclobutyl)-3-[4-(difluoromethoxy)-2-phenylquinolin-7-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc3c(OC(F)F)cc(-c4ccccc4)nc3c2)nn(C2CC(N)(O)C2)c1N |
| InChI | InChI=1S/C24H22F2N6O3/c25-23(26)35-18-9-16(12-4-2-1-3-5-12)30-17-8-13(6-7-15(17)18)20-19(22(28)33)21(27)32(31-20)14-10-24(29,34)11-14/h1-9,14,23,34H,10-11,27,29H2,(H2,28,33) |
| InChIKey | KRUIZUXKCSYXTK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 155.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|