C16H23F3N6O — CID 170094311
N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methoxy]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 170094311) has the molecular formula C16H23F3N6O and a molecular weight of 372.40 g/mol. Its IUPAC name is N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methoxy]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methoxy]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 170094311 |
| Molecular Formula | C16H23F3N6O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-tert-butyl-2-[(1-tert-butyltriazol-4-yl)methoxy]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CC(C)(C)Nc1cc(C(F)(F)F)nc(OCc2cn(C(C)(C)C)nn2)n1 |
| InChI | InChI=1S/C16H23F3N6O/c1-14(2,3)22-12-7-11(16(17,18)19)20-13(21-12)26-9-10-8-25(24-23-10)15(4,5)6/h7-8H,9H2,1-6H3,(H,20,21,22) |
| InChIKey | LZXDIIDZGHIAOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |