C29H30ClFN6 — CID 170096588
1-[4-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-chloro-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylazetidin-3-amine (PubChem CID 170096588) has the molecular formula C29H30ClFN6 and a molecular weight of 517.05 g/mol. Its IUPAC name is 1-[4-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-chloro-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylazetidin-3-amine.
| Compound Name | 1-[4-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-chloro-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylazetidin-3-amine |
|---|---|
| PubChem CID | 170096588 |
| Molecular Formula | C29H30ClFN6 |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-[4-(2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-4-yl)-6-chloro-8-fluoro-7-naphthalen-1-ylquinazolin-2-yl]-N,N-dimethylazetidin-3-amine |
| SMILES | CN(C)C1CN(c2nc(N3CCC4NCCC43)c3cc(Cl)c(-c4cccc5ccccc45)c(F)c3n2)C1 |
| InChI | InChI=1S/C29H30ClFN6/c1-35(2)18-15-36(16-18)29-33-27-21(28(34-29)37-13-11-23-24(37)10-12-32-23)14-22(30)25(26(27)31)20-9-5-7-17-6-3-4-8-19(17)20/h3-9,14,18,23-24,32H,10-13,15-16H2,1-2H3 |
| InChIKey | PJSAUTVGIVRQDU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |